C14H20N2O2 — CID 130441723
1-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1,3-diazinane-2,4-dione (PubChem CID 130441723) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 130441723 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C=C\C(=C/C)CCCN1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H20N2O2/c1-3-5-7-12(4-2)8-6-10-16-11-9-13(17)15-14(16)18/h3-5,7H,1,6,8-11H2,2H3,(H,15,17,18)/b7-5-,12-4+ |
| InChIKey | GAJLQBBOXDZGRC-NIZDWENVSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|