C14H20N4O3 — CID 130441749
N-[2-[(2-hydroxy-5-oxopyrrolidin-3-yl)amino]ethyl]-2-(methylamino)benzamide (PubChem CID 130441749) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[2-[(2-hydroxy-5-oxopyrrolidin-3-yl)amino]ethyl]-2-(methylamino)benzamide.
| Compound Name | N-[2-[(2-hydroxy-5-oxopyrrolidin-3-yl)amino]ethyl]-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 130441749 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[2-[(2-hydroxy-5-oxopyrrolidin-3-yl)amino]ethyl]-2-(methylamino)benzamide |
| SMILES | CNc1ccccc1C(=O)NCCNC1CC(=O)NC1O |
| InChI | InChI=1S/C14H20N4O3/c1-15-10-5-3-2-4-9(10)13(20)17-7-6-16-11-8-12(19)18-14(11)21/h2-5,11,14-16,21H,6-8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | NAYFZPGYFXIYGE-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|