C14H19N3O3 — CID 130441907
(2E)-N-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide (PubChem CID 130441907) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2E)-N-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 130441907 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2E)-N-[2-(2,4-dioxo-1,3-diazinan-1-yl)ethyl]-2-[(Z)-prop-1-enyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C/C)C(=O)NCCN1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H19N3O3/c1-3-5-11(6-4-2)13(19)15-8-10-17-9-7-12(18)16-14(17)20/h3-6H,1,7-10H2,2H3,(H,15,19)(H,16,18,20)/b6-4-,11-5+ |
| InChIKey | LLEJPEZYWKVXSS-NQTKGXIKSA-N |
| XLogP | 0.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|