About 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one
2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 130441956) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one |
| PubChem CID | 130441956 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CC1C=CC(O)NC1=O |
| InChI | InChI=1S/C6H9NO2/c1-4-2-3-5(8)7-6(4)9/h2-5,8H,1H3,(H,7,9) |
| InChIKey | UQCJRPDQCUVSLJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one?
The IUPAC name of 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one (CID 130441956) is 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one.
What is the SMILES notation for 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one?
The canonical SMILES for 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one is CC1C=CC(O)NC1=O.
What is the InChIKey of 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one?
The InChIKey is UQCJRPDQCUVSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4-2-3-5(8)7-6(4)9/h2-5,8H,1H3,(H,7,9).
What are the key properties of 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one?
2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one has a molecular weight of 127.14 g/mol, XLogP of -0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-methyl-2,5-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 130441956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).