C9H17I3O — CID 130441965
5,5,5-triiodo-2,2,4,4-tetramethylpentan-1-ol (PubChem CID 130441965) has the molecular formula C9H17I3O and a molecular weight of 521.95 g/mol. Its IUPAC name is 5,5,5-triiodo-2,2,4,4-tetramethylpentan-1-ol.
| Compound Name | 5,5,5-triiodo-2,2,4,4-tetramethylpentan-1-ol |
|---|---|
| PubChem CID | 130441965 |
| Molecular Formula | C9H17I3O |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.84 |
| IUPAC Name | 5,5,5-triiodo-2,2,4,4-tetramethylpentan-1-ol |
| SMILES | CC(C)(CO)CC(C)(C)C(I)(I)I |
| InChI | InChI=1S/C9H17I3O/c1-7(2,6-13)5-8(3,4)9(10,11)12/h13H,5-6H2,1-4H3 |
| InChIKey | OJRLRPPCGPJSEQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|