About 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane
3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane (PubChem CID 130442030) has the molecular formula C15H30F2
and a molecular weight of 248.40 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane.
Analyze 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane?
The IUPAC name of 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane (CID 130442030) is 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane.
What is the SMILES notation for 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane?
The canonical SMILES for 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane is CCC(C)(C)CC(C)(CC)C(C)(CC)C(F)F.
What is the InChIKey of 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane?
The InChIKey is QSRKFRQJMXIIEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F2/c1-8-13(4,5)11-14(6,9-2)15(7,10-3)12(16)17/h12H,8-11H2,1-7H3.
What are the key properties of 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane?
3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane has a molecular weight of 248.40 g/mol, XLogP of 5.91, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-4-ethyl-3,4,6,6-tetramethyloctane is sourced from PubChem (CID 130442030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).