About 1-thiocyanatopropyl thiocyanate
1-thiocyanatopropyl thiocyanate (PubChem CID 130442448) has the molecular formula C5H6N2S2
and a molecular weight of 158.25 g/mol. Its IUPAC name is 1-thiocyanatopropyl thiocyanate.
Molecular Properties
| Compound Name | 1-thiocyanatopropyl thiocyanate |
| PubChem CID | 130442448 |
| Molecular Formula | C5H6N2S2 |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | 1-thiocyanatopropyl thiocyanate |
| SMILES | CCC(SC#N)SC#N |
| InChI | InChI=1S/C5H6N2S2/c1-2-5(8-3-6)9-4-7/h5H,2H2,1H3 |
| InChIKey | YOXWZLJGHMTMOR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-thiocyanatopropyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thiocyanatopropyl thiocyanate?
The IUPAC name of 1-thiocyanatopropyl thiocyanate (CID 130442448) is 1-thiocyanatopropyl thiocyanate.
What is the SMILES notation for 1-thiocyanatopropyl thiocyanate?
The canonical SMILES for 1-thiocyanatopropyl thiocyanate is CCC(SC#N)SC#N.
What is the InChIKey of 1-thiocyanatopropyl thiocyanate?
The InChIKey is YOXWZLJGHMTMOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2S2/c1-2-5(8-3-6)9-4-7/h5H,2H2,1H3.
What are the key properties of 1-thiocyanatopropyl thiocyanate?
1-thiocyanatopropyl thiocyanate has a molecular weight of 158.25 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thiocyanatopropyl thiocyanate is sourced from PubChem (CID 130442448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).