About 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine
4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine (PubChem CID 130442480) has the molecular formula C21H13F3N4O2
and a molecular weight of 410.36 g/mol. Its IUPAC name is 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine |
| PubChem CID | 130442480 |
| Molecular Formula | C21H13F3N4O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine |
| SMILES | Cc1ncc2nccn2c1-c1ccc(Oc2nccc3occc23)cc1C(F)(F)F |
| InChI | InChI=1S/C21H13F3N4O2/c1-12-19(28-8-7-25-18(28)11-27-12)14-3-2-13(10-16(14)21(22,23)24)30-20-15-5-9-29-17(15)4-6-26-20/h2-11H,1H3 |
| InChIKey | GEPUWJGKAOGNRH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine?
The IUPAC name of 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine (CID 130442480) is 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine.
What is the SMILES notation for 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine?
The canonical SMILES for 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine is Cc1ncc2nccn2c1-c1ccc(Oc2nccc3occc23)cc1C(F)(F)F.
What is the InChIKey of 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine?
The InChIKey is GEPUWJGKAOGNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13F3N4O2/c1-12-19(28-8-7-25-18(28)11-27-12)14-3-2-13(10-16(14)21(22,23)24)30-20-15-5-9-29-17(15)4-6-26-20/h2-11H,1H3.
What are the key properties of 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine?
4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine has a molecular weight of 410.36 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(6-methylimidazo[1,2-a]pyrazin-5-yl)-3-(trifluoromethyl)phenoxy]furo[3,2-c]pyridine is sourced from PubChem (CID 130442480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).