About 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate
2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate (PubChem CID 13044270) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
Analyze 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate?
The IUPAC name of 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate (CID 13044270) is 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate.
What is the SMILES notation for 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate?
The canonical SMILES for 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate is CC(C)COC(=O)C1Cc2ccccc2CN1.
What is the InChIKey of 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate?
The InChIKey is FHCCIHRPQXPEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-10(2)9-17-14(16)13-7-11-5-3-4-6-12(11)8-15-13/h3-6,10,13,15H,7-9H2,1-2H3.
What are the key properties of 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate?
2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate has a molecular weight of 233.31 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate is sourced from PubChem (CID 13044270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).