About [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate (PubChem CID 130442805) has the molecular formula C20H19N5O2S
and a molecular weight of 393.47 g/mol. Its IUPAC name is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate.
Molecular Properties
| Compound Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate |
| PubChem CID | 130442805 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate |
| SMILES | NC[C@@H](NC(=O)Oc1ccsc1Nc1ccnc2[nH]ccc12)c1ccccc1 |
| InChI | InChI=1S/C20H19N5O2S/c21-12-16(13-4-2-1-3-5-13)25-20(26)27-17-8-11-28-19(17)24-15-7-10-23-18-14(15)6-9-22-18/h1-11,16H,12,21H2,(H,25,26)(H2,22,23,24)/t16-/m1/s1 |
| InChIKey | STNVKXJTOBNTSX-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate?
The IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate (CID 130442805) is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate.
What is the SMILES notation for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate?
The canonical SMILES for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate is NC[C@@H](NC(=O)Oc1ccsc1Nc1ccnc2[nH]ccc12)c1ccccc1.
What is the InChIKey of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate?
The InChIKey is STNVKXJTOBNTSX-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H19N5O2S/c21-12-16(13-4-2-1-3-5-13)25-20(26)27-17-8-11-28-19(17)24-15-7-10-23-18-14(15)6-9-22-18/h1-11,16H,12,21H2,(H,25,26)(H2,22,23,24)/t16-/m1/s1.
What are the key properties of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate?
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate has a molecular weight of 393.47 g/mol, XLogP of 4.16, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[(1S)-2-amino-1-phenylethyl]carbamate is sourced from PubChem (CID 130442805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).