About [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate (PubChem CID 130442816) has the molecular formula C21H21N5O2S
and a molecular weight of 407.50 g/mol. Its IUPAC name is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate.
Molecular Properties
| Compound Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate |
| PubChem CID | 130442816 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate |
| SMILES | O=C(NCCNCc1ccccc1)Oc1ccsc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C21H21N5O2S/c27-21(25-12-11-22-14-15-4-2-1-3-5-15)28-18-8-13-29-20(18)26-17-7-10-24-19-16(17)6-9-23-19/h1-10,13,22H,11-12,14H2,(H,25,27)(H2,23,24,26) |
| InChIKey | OBFKEPJZRMKAOS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate?
The IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate (CID 130442816) is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate.
What is the SMILES notation for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate?
The canonical SMILES for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate is O=C(NCCNCc1ccccc1)Oc1ccsc1Nc1ccnc2[nH]ccc12.
What is the InChIKey of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate?
The InChIKey is OBFKEPJZRMKAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O2S/c27-21(25-12-11-22-14-15-4-2-1-3-5-15)28-18-8-13-29-20(18)26-17-7-10-24-19-16(17)6-9-23-19/h1-10,13,22H,11-12,14H2,(H,25,27)(H2,23,24,26).
What are the key properties of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate?
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate has a molecular weight of 407.50 g/mol, XLogP of 4.25, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-[2-(benzylamino)ethyl]carbamate is sourced from PubChem (CID 130442816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).