About [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate (PubChem CID 130442846) has the molecular formula C19H16N4O2S
and a molecular weight of 364.43 g/mol. Its IUPAC name is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate.
Molecular Properties
| Compound Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate |
| PubChem CID | 130442846 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)Oc1ccsc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C19H16N4O2S/c24-19(22-12-13-4-2-1-3-5-13)25-16-8-11-26-18(16)23-15-7-10-21-17-14(15)6-9-20-17/h1-11H,12H2,(H,22,24)(H2,20,21,23) |
| InChIKey | VXZSXDKYFARRLY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate?
The IUPAC name of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate (CID 130442846) is [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate.
What is the SMILES notation for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate?
The canonical SMILES for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate is O=C(NCc1ccccc1)Oc1ccsc1Nc1ccnc2[nH]ccc12.
What is the InChIKey of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate?
The InChIKey is VXZSXDKYFARRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S/c24-19(22-12-13-4-2-1-3-5-13)25-16-8-11-26-18(16)23-15-7-10-21-17-14(15)6-9-20-17/h1-11H,12H2,(H,22,24)(H2,20,21,23).
What are the key properties of [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate?
[2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate has a molecular weight of 364.43 g/mol, XLogP of 4.66, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-3-yl] N-benzylcarbamate is sourced from PubChem (CID 130442846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).