About 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide
1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide (PubChem CID 130443119) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide |
| PubChem CID | 130443119 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide |
| SMILES | Cn1ncc(C(N)=O)c1C(=O)N[C@H]1CCOC1 |
| InChI | InChI=1S/C10H14N4O3/c1-14-8(7(4-12-14)9(11)15)10(16)13-6-2-3-17-5-6/h4,6H,2-3,5H2,1H3,(H2,11,15)(H,13,16)/t6-/m0/s1 |
| InChIKey | DPOUYLZRICVSQD-LURJTMIESA-N |
| XLogP | -0.96 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide?
The IUPAC name of 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide (CID 130443119) is 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide.
What is the SMILES notation for 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide?
The canonical SMILES for 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide is Cn1ncc(C(N)=O)c1C(=O)N[C@H]1CCOC1.
What is the InChIKey of 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide?
The InChIKey is DPOUYLZRICVSQD-LURJTMIESA-N. The full InChI is InChI=1S/C10H14N4O3/c1-14-8(7(4-12-14)9(11)15)10(16)13-6-2-3-17-5-6/h4,6H,2-3,5H2,1H3,(H2,11,15)(H,13,16)/t6-/m0/s1.
What are the key properties of 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide?
1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide has a molecular weight of 238.25 g/mol, XLogP of -0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-N-[(3S)-oxolan-3-yl]pyrazole-4,5-dicarboxamide is sourced from PubChem (CID 130443119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).