C6H7NO5 — CID 130443728
6-aminobenzene-1,2,3,4,5-pentol (PubChem CID 130443728) has the molecular formula C6H7NO5 and a molecular weight of 173.12 g/mol. Its IUPAC name is 6-aminobenzene-1,2,3,4,5-pentol.
| Compound Name | 6-aminobenzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 130443728 |
| Molecular Formula | C6H7NO5 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 6-aminobenzene-1,2,3,4,5-pentol |
| SMILES | Nc1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C6H7NO5/c7-1-2(8)4(10)6(12)5(11)3(1)9/h8-12H,7H2 |
| InChIKey | GABCWWWSYKJZRK-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|