C36H41F2N5O5 — CID 130444053
1-N'-[3-fluoro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]-1,8a-dihydroquinolin-4-yl]oxy]phenyl]-1-N-(4-fluorophenyl)cyclobutane-1,1-dicarboxamide (PubChem CID 130444053) has the molecular formula C36H41F2N5O5 and a molecular weight of 661.75 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]-1,8a-dihydroquinolin-4-yl]oxy]phenyl]-1-N-(4-fluorophenyl)cyclobutane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]-1,8a-dihydroquinolin-4-yl]oxy]phenyl]-1-N-(4-fluorophenyl)cyclobutane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 130444053 |
| Molecular Formula | C36H41F2N5O5 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | 1-N'-[3-fluoro-4-[[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]-1,8a-dihydroquinolin-4-yl]oxy]phenyl]-1-N-(4-fluorophenyl)cyclobutane-1,1-dicarboxamide |
| SMILES | COC1=CC2=C(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CCC4)cc3F)C=CNC2C=C1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C36H41F2N5O5/c1-42-16-18-43(19-17-42)15-4-20-47-33-23-29-27(22-32(33)46-2)30(11-14-39-29)48-31-10-9-26(21-28(31)38)41-35(45)36(12-3-13-36)34(44)40-25-7-5-24(37)6-8-25/h5-11,14,21-23,29,39H,3-4,12-13,15-20H2,1-2H3,(H,40,44)(H,41,45) |
| InChIKey | IISSMNJXMLYIJZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|