C27H34Cl2N4O — CID 130444206
7-amino-1-[4-[1-[1-(2,4-dichlorocyclohexa-1,5-dien-1-yl)ethyl]indazol-6-yl]-3,6-dihydro-2H-pyridin-1-yl]heptan-1-one (PubChem CID 130444206) has the molecular formula C27H34Cl2N4O and a molecular weight of 501.50 g/mol. Its IUPAC name is 7-amino-1-[4-[1-[1-(2,4-dichlorocyclohexa-1,5-dien-1-yl)ethyl]indazol-6-yl]-3,6-dihydro-2H-pyridin-1-yl]heptan-1-one.
| Compound Name | 7-amino-1-[4-[1-[1-(2,4-dichlorocyclohexa-1,5-dien-1-yl)ethyl]indazol-6-yl]-3,6-dihydro-2H-pyridin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 130444206 |
| Molecular Formula | C27H34Cl2N4O |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 7-amino-1-[4-[1-[1-(2,4-dichlorocyclohexa-1,5-dien-1-yl)ethyl]indazol-6-yl]-3,6-dihydro-2H-pyridin-1-yl]heptan-1-one |
| SMILES | CC(C1=C(Cl)CC(Cl)C=C1)n1ncc2ccc(C3=CCN(C(=O)CCCCCCN)CC3)cc21 |
| InChI | InChI=1S/C27H34Cl2N4O/c1-19(24-10-9-23(28)17-25(24)29)33-26-16-21(7-8-22(26)18-31-33)20-11-14-32(15-12-20)27(34)6-4-2-3-5-13-30/h7-11,16,18-19,23H,2-6,12-15,17,30H2,1H3 |
| InChIKey | SYBCFTXISNLZJO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|