C23H44N2 — CID 130444245
(Z)-N'-[(Z)-2-methylhept-2-enyl]-N'-[(E)-2,4,4,7-tetramethylnon-7-en-2-yl]ethene-1,2-diamine (PubChem CID 130444245) has the molecular formula C23H44N2 and a molecular weight of 348.62 g/mol. Its IUPAC name is (Z)-N'-[(Z)-2-methylhept-2-enyl]-N'-[(E)-2,4,4,7-tetramethylnon-7-en-2-yl]ethene-1,2-diamine.
| Compound Name | (Z)-N'-[(Z)-2-methylhept-2-enyl]-N'-[(E)-2,4,4,7-tetramethylnon-7-en-2-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 130444245 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | (Z)-N'-[(Z)-2-methylhept-2-enyl]-N'-[(E)-2,4,4,7-tetramethylnon-7-en-2-yl]ethene-1,2-diamine |
| SMILES | C/C=C(\C)CCC(C)(C)CC(C)(C)N(/C=C\N)C/C(C)=C\CCCC |
| InChI | InChI=1S/C23H44N2/c1-9-11-12-13-21(4)18-25(17-16-24)23(7,8)19-22(5,6)15-14-20(3)10-2/h10,13,16-17H,9,11-12,14-15,18-19,24H2,1-8H3/b17-16-,20-10+,21-13- |
| InChIKey | CFGDAMQPROJXCW-IHHZGFKASA-N |
| XLogP | 6.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|