C25H27FN3O3PS — CID 130445022
4-[(2-fluorophenyl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 130445022) has the molecular formula C25H27FN3O3PS and a molecular weight of 499.55 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(2-fluorophenyl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 130445022 |
| Molecular Formula | C25H27FN3O3PS |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[(2-fluorophenyl)-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=P1(C(c2ccccc2F)N2CCS(=O)(=O)CC2)N(c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C25H27FN3O3PS/c26-24-14-8-7-13-23(24)25(27-17-19-34(31,32)20-18-27)33(30)28(21-9-3-1-4-10-21)15-16-29(33)22-11-5-2-6-12-22/h1-14,25H,15-20H2 |
| InChIKey | LIYFNJZQPWNUSV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|