C18H31N — CID 130445215
4-ethyl-2,3,5,5,6,6-hexamethyl-1-[(2Z)-penta-2,4-dienyl]-2H-pyridine (PubChem CID 130445215) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 4-ethyl-2,3,5,5,6,6-hexamethyl-1-[(2Z)-penta-2,4-dienyl]-2H-pyridine.
| Compound Name | 4-ethyl-2,3,5,5,6,6-hexamethyl-1-[(2Z)-penta-2,4-dienyl]-2H-pyridine |
|---|---|
| PubChem CID | 130445215 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 4-ethyl-2,3,5,5,6,6-hexamethyl-1-[(2Z)-penta-2,4-dienyl]-2H-pyridine |
| SMILES | C=C/C=C\CN1C(C)C(C)=C(CC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C18H31N/c1-9-11-12-13-19-15(4)14(3)16(10-2)17(5,6)18(19,7)8/h9,11-12,15H,1,10,13H2,2-8H3/b12-11- |
| InChIKey | LSURHDDLRBVEOO-QXMHVHEDSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|