C23H22ClF2N5O5 — CID 130445691
7-[(6-chloro-3-pyridinyl)methyl]-8-[3-(1,1-difluoroethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione (PubChem CID 130445691) has the molecular formula C23H22ClF2N5O5 and a molecular weight of 521.91 g/mol. Its IUPAC name is 7-[(6-chloro-3-pyridinyl)methyl]-8-[3-(1,1-difluoroethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(6-chloro-3-pyridinyl)methyl]-8-[3-(1,1-difluoroethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 130445691 |
| Molecular Formula | C23H22ClF2N5O5 |
| Molecular Weight | 521.91 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 7-[(6-chloro-3-pyridinyl)methyl]-8-[3-(1,1-difluoroethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CCCO)c(=O)c2c1nc(Oc1cccc(OC(C)(F)F)c1)n2Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C23H22ClF2N5O5/c1-23(25,26)36-16-6-3-5-15(11-16)35-21-28-19-18(31(21)13-14-7-8-17(24)27-12-14)20(33)30(9-4-10-32)22(34)29(19)2/h3,5-8,11-12,32H,4,9-10,13H2,1-2H3 |
| InChIKey | DOARCVOLNCLKCU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.91 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|