C25H25ClF2N4O5 — CID 130445708
7-[(4-chlorophenyl)methyl]-8-[3-(1,1-difluoroethyl)phenoxy]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione (PubChem CID 130445708) has the molecular formula C25H25ClF2N4O5 and a molecular weight of 534.95 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-[3-(1,1-difluoroethyl)phenoxy]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-[3-(1,1-difluoroethyl)phenoxy]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 130445708 |
| Molecular Formula | C25H25ClF2N4O5 |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-[3-(1,1-difluoroethyl)phenoxy]-1-[2-(2-hydroxyethoxy)ethyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(CCOCCO)c(=O)c2c1nc(Oc1cccc(C(C)(F)F)c1)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClF2N4O5/c1-25(27,28)17-4-3-5-19(14-17)37-23-29-21-20(32(23)15-16-6-8-18(26)9-7-16)22(34)31(24(35)30(21)2)10-12-36-13-11-33/h3-9,14,33H,10-13,15H2,1-2H3 |
| InChIKey | WOJRRIYBGLFWAJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|