C16H29F6NOS — CID 130445993
[2-methyl-2-[3,3,5-trimethyl-4,4-bis(trifluoromethyl)hexoxy]propyl]sulfanylmethanamine (PubChem CID 130445993) has the molecular formula C16H29F6NOS and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-methyl-2-[3,3,5-trimethyl-4,4-bis(trifluoromethyl)hexoxy]propyl]sulfanylmethanamine.
| Compound Name | [2-methyl-2-[3,3,5-trimethyl-4,4-bis(trifluoromethyl)hexoxy]propyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 130445993 |
| Molecular Formula | C16H29F6NOS |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-methyl-2-[3,3,5-trimethyl-4,4-bis(trifluoromethyl)hexoxy]propyl]sulfanylmethanamine |
| SMILES | CC(C)C(C(F)(F)F)(C(F)(F)F)C(C)(C)CCOC(C)(C)CSCN |
| InChI | InChI=1S/C16H29F6NOS/c1-11(2)14(15(17,18)19,16(20,21)22)12(3,4)7-8-24-13(5,6)9-25-10-23/h11H,7-10,23H2,1-6H3 |
| InChIKey | GOMGLZLOBZQAET-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|