About N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide
N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide (PubChem CID 130446244) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide.
Molecular Properties
| Compound Name | N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide |
| PubChem CID | 130446244 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide |
| SMILES | C=C/C=C\C(=C/C=C)CNC=O |
| InChI | InChI=1S/C10H13NO/c1-3-5-7-10(6-4-2)8-11-9-12/h3-7,9H,1-2,8H2,(H,11,12)/b7-5-,10-6+ |
| InChIKey | IBGAILWSWHNJHH-ZPRNNRRZSA-N |
| XLogP | 1.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide?
The IUPAC name of N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide (CID 130446244) is N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide.
What is the SMILES notation for N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide?
The canonical SMILES for N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide is C=C/C=C\C(=C/C=C)CNC=O.
What is the InChIKey of N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide?
The InChIKey is IBGAILWSWHNJHH-ZPRNNRRZSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-5-7-10(6-4-2)8-11-9-12/h3-7,9H,1-2,8H2,(H,11,12)/b7-5-,10-6+.
What are the key properties of N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide?
N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide has a molecular weight of 163.22 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]formamide is sourced from PubChem (CID 130446244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).