C25H26N2O3S — CID 130446450
6,7-dihydroxy-N-[2-(4-methoxyphenyl)ethyl]-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 130446450) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 6,7-dihydroxy-N-[2-(4-methoxyphenyl)ethyl]-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 6,7-dihydroxy-N-[2-(4-methoxyphenyl)ethyl]-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 130446450 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6,7-dihydroxy-N-[2-(4-methoxyphenyl)ethyl]-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)N2CCc3cc(O)c(O)cc3C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-30-20-9-7-17(8-10-20)11-13-26-25(31)27-14-12-19-15-22(28)23(29)16-21(19)24(27)18-5-3-2-4-6-18/h2-10,15-16,24,28-29H,11-14H2,1H3,(H,26,31) |
| InChIKey | DMXIRCMEYVDOFH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|