About methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate
methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate (PubChem CID 130446689) has the molecular formula C28H24N2O3
and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate |
| PubChem CID | 130446689 |
| Molecular Formula | C28H24N2O3 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(CNC(=O)[C@@H]3C[C@H]3c3ccccc3)c3cnccc23)c1 |
| InChI | InChI=1S/C28H24N2O3/c1-33-28(32)20-9-5-8-19(14-20)22-11-10-21(26-17-29-13-12-23(22)26)16-30-27(31)25-15-24(25)18-6-3-2-4-7-18/h2-14,17,24-25H,15-16H2,1H3,(H,30,31)/t24-,25+/m0/s1 |
| InChIKey | YIDUBRPEFFSOFF-LOSJGSFVSA-N |
| XLogP | 5.11 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate?
The IUPAC name of methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate (CID 130446689) is methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate.
What is the SMILES notation for methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate?
The canonical SMILES for methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate is COC(=O)c1cccc(-c2ccc(CNC(=O)[C@@H]3C[C@H]3c3ccccc3)c3cnccc23)c1.
What is the InChIKey of methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate?
The InChIKey is YIDUBRPEFFSOFF-LOSJGSFVSA-N. The full InChI is InChI=1S/C28H24N2O3/c1-33-28(32)20-9-5-8-19(14-20)22-11-10-21(26-17-29-13-12-23(22)26)16-30-27(31)25-15-24(25)18-6-3-2-4-7-18/h2-14,17,24-25H,15-16H2,1H3,(H,30,31)/t24-,25+/m0/s1.
What are the key properties of methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate?
methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate has a molecular weight of 436.51 g/mol, XLogP of 5.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[8-[[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]methyl]isoquinolin-5-yl]benzoate is sourced from PubChem (CID 130446689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).