C13H16O4 — CID 130446694
7-(methoxymethoxy)-1a-methyl-1,3a,7a,7b-tetrahydrocyclopropa[c]chromen-2-one (PubChem CID 130446694) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 7-(methoxymethoxy)-1a-methyl-1,3a,7a,7b-tetrahydrocyclopropa[c]chromen-2-one.
| Compound Name | 7-(methoxymethoxy)-1a-methyl-1,3a,7a,7b-tetrahydrocyclopropa[c]chromen-2-one |
|---|---|
| PubChem CID | 130446694 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 7-(methoxymethoxy)-1a-methyl-1,3a,7a,7b-tetrahydrocyclopropa[c]chromen-2-one |
| SMILES | COCOC1=CC=CC2OC(=O)C3(C)CC3C12 |
| InChI | InChI=1S/C13H16O4/c1-13-6-8(13)11-9(16-7-15-2)4-3-5-10(11)17-12(13)14/h3-5,8,10-11H,6-7H2,1-2H3 |
| InChIKey | QUDGIEHGKCMRMO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|