About 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol
5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol (PubChem CID 130446799) has the molecular formula C22H24F2N4O
and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol.
Molecular Properties
| Compound Name | 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol |
| PubChem CID | 130446799 |
| Molecular Formula | C22H24F2N4O |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol |
| SMILES | CN(C)C1CCC(Nc2ncnc3ccc(-c4cc(O)c(F)c(F)c4)cc23)CC1 |
| InChI | InChI=1S/C22H24F2N4O/c1-28(2)16-6-4-15(5-7-16)27-22-17-9-13(3-8-19(17)25-12-26-22)14-10-18(23)21(24)20(29)11-14/h3,8-12,15-16,29H,4-7H2,1-2H3,(H,25,26,27) |
| InChIKey | TZLUAPAYMGPEES-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol?
The IUPAC name of 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol (CID 130446799) is 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol.
What is the SMILES notation for 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol?
The canonical SMILES for 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol is CN(C)C1CCC(Nc2ncnc3ccc(-c4cc(O)c(F)c(F)c4)cc23)CC1.
What is the InChIKey of 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol?
The InChIKey is TZLUAPAYMGPEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F2N4O/c1-28(2)16-6-4-15(5-7-16)27-22-17-9-13(3-8-19(17)25-12-26-22)14-10-18(23)21(24)20(29)11-14/h3,8-12,15-16,29H,4-7H2,1-2H3,(H,25,26,27).
What are the key properties of 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol?
5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol has a molecular weight of 398.46 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[[4-(dimethylamino)cyclohexyl]amino]quinazolin-6-yl]-2,3-difluorophenol is sourced from PubChem (CID 130446799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).