C25H31FN6O — CID 130446890
6-(5-amino-6-fluoro-3-pyridinyl)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine (PubChem CID 130446890) has the molecular formula C25H31FN6O and a molecular weight of 450.56 g/mol. Its IUPAC name is 6-(5-amino-6-fluoro-3-pyridinyl)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine.
| Compound Name | 6-(5-amino-6-fluoro-3-pyridinyl)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 130446890 |
| Molecular Formula | C25H31FN6O |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 6-(5-amino-6-fluoro-3-pyridinyl)-N-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]cyclohexyl]quinazolin-4-amine |
| SMILES | C[C@@H]1CN(C2CCC(Nc3ncnc4ccc(-c5cnc(F)c(N)c5)cc34)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H31FN6O/c1-15-12-32(13-16(2)33-15)20-6-4-19(5-7-20)31-25-21-9-17(3-8-23(21)29-14-30-25)18-10-22(27)24(26)28-11-18/h3,8-11,14-16,19-20H,4-7,12-13,27H2,1-2H3,(H,29,30,31)/t15-,16+,19?,20? |
| InChIKey | BDFVLCKTWCMIIG-BANKROOTSA-N |
| XLogP | 4.25 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|