About 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride
2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride (PubChem CID 13044733) has the molecular formula C8H7ClF6O
and a molecular weight of 268.58 g/mol. Its IUPAC name is 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride.
Molecular Properties
| Compound Name | 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride |
| PubChem CID | 13044733 |
| Molecular Formula | C8H7ClF6O |
| Molecular Weight | 268.58 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride |
| SMILES | CC1(C(F)(F)F)C(C(=O)Cl)C1(C)C(F)(F)F |
| InChI | InChI=1S/C8H7ClF6O/c1-5(7(10,11)12)3(4(9)16)6(5,2)8(13,14)15/h3H,1-2H3 |
| InChIKey | BNUKVAMNQBSEAU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride?
The IUPAC name of 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride (CID 13044733) is 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride.
What is the SMILES notation for 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride?
The canonical SMILES for 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride is CC1(C(F)(F)F)C(C(=O)Cl)C1(C)C(F)(F)F.
What is the InChIKey of 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride?
The InChIKey is BNUKVAMNQBSEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF6O/c1-5(7(10,11)12)3(4(9)16)6(5,2)8(13,14)15/h3H,1-2H3.
What are the key properties of 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride?
2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride has a molecular weight of 268.58 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-2,3-bis(trifluoromethyl)cyclopropane-1-carbonyl chloride is sourced from PubChem (CID 13044733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).