C30H31N9O3 — CID 130447835
N-[4-(4-amino-7-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-5-yl)phenyl]-3,5-dioxo-4-phenyl-2-propan-2-yl-1,2,4-triazine-6-carboxamide (PubChem CID 130447835) has the molecular formula C30H31N9O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is N-[4-(4-amino-7-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-5-yl)phenyl]-3,5-dioxo-4-phenyl-2-propan-2-yl-1,2,4-triazine-6-carboxamide.
| Compound Name | N-[4-(4-amino-7-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-5-yl)phenyl]-3,5-dioxo-4-phenyl-2-propan-2-yl-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 130447835 |
| Molecular Formula | C30H31N9O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | N-[4-(4-amino-7-piperidin-4-ylpyrrolo[2,1-f][1,2,4]triazin-5-yl)phenyl]-3,5-dioxo-4-phenyl-2-propan-2-yl-1,2,4-triazine-6-carboxamide |
| SMILES | CC(C)n1nc(C(=O)Nc2ccc(-c3cc(C4CCNCC4)n4ncnc(N)c34)cc2)c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C30H31N9O3/c1-18(2)38-30(42)37(22-6-4-3-5-7-22)29(41)25(36-38)28(40)35-21-10-8-19(9-11-21)23-16-24(20-12-14-32-15-13-20)39-26(23)27(31)33-17-34-39/h3-11,16-18,20,32H,12-15H2,1-2H3,(H,35,40)(H2,31,33,34) |
| InChIKey | ZDYOJGLEZJWDSL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 154.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |