C16H15Cl3N4 — CID 130447895
3-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]propan-1-amine (PubChem CID 130447895) has the molecular formula C16H15Cl3N4 and a molecular weight of 369.68 g/mol. Its IUPAC name is 3-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]propan-1-amine.
| Compound Name | 3-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 130447895 |
| Molecular Formula | C16H15Cl3N4 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 3-(5-chloro-1H-imidazo[4,5-b]pyridin-2-yl)-N-[(3,5-dichlorophenyl)methyl]propan-1-amine |
| SMILES | Clc1cc(Cl)cc(CNCCCc2nc3nc(Cl)ccc3[nH]2)c1 |
| InChI | InChI=1S/C16H15Cl3N4/c17-11-6-10(7-12(18)8-11)9-20-5-1-2-15-21-13-3-4-14(19)22-16(13)23-15/h3-4,6-8,20H,1-2,5,9H2,(H,21,22,23) |
| InChIKey | QXDNWXCSVXOSNT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|