C15H17F2N3O3S — CID 130448706
4-[(1S,3S)-3-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylcyclopropyl]benzenesulfonamide (PubChem CID 130448706) has the molecular formula C15H17F2N3O3S and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-[(1S,3S)-3-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylcyclopropyl]benzenesulfonamide.
| Compound Name | 4-[(1S,3S)-3-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylcyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 130448706 |
| Molecular Formula | C15H17F2N3O3S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[(1S,3S)-3-[5-(1,1-difluoroethyl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylcyclopropyl]benzenesulfonamide |
| SMILES | CC(F)(F)c1nc([C@H]2[C@H](c3ccc(S(N)(=O)=O)cc3)C2(C)C)no1 |
| InChI | InChI=1S/C15H17F2N3O3S/c1-14(2)10(8-4-6-9(7-5-8)24(18,21)22)11(14)12-19-13(23-20-12)15(3,16)17/h4-7,10-11H,1-3H3,(H2,18,21,22)/t10-,11+/m0/s1 |
| InChIKey | WEIDDTAQCANVDJ-WDEREUQCSA-N |
| XLogP | 2.74 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |