C26H30F3N5O2S — CID 130449434
2-N-tert-butyl-8-N-[1-(1,3,4-thiadiazol-2-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 130449434) has the molecular formula C26H30F3N5O2S and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-N-tert-butyl-8-N-[1-(1,3,4-thiadiazol-2-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-tert-butyl-8-N-[1-(1,3,4-thiadiazol-2-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 130449434 |
| Molecular Formula | C26H30F3N5O2S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 2-N-tert-butyl-8-N-[1-(1,3,4-thiadiazol-2-yl)ethyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | CC(NC(=O)C1C=CC(c2cccc(C(F)(F)F)c2)=C2CCN(C(=O)NC(C)(C)C)CC21)c1nncs1 |
| InChI | InChI=1S/C26H30F3N5O2S/c1-15(23-33-30-14-37-23)31-22(35)20-9-8-18(16-6-5-7-17(12-16)26(27,28)29)19-10-11-34(13-21(19)20)24(36)32-25(2,3)4/h5-9,12,14-15,20-21H,10-11,13H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | JCPFKLYIMOXWQY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |