C28H33F3N4O3 — CID 130449481
2-N-tert-butyl-8-N-[2-(1,3-oxazol-2-yl)propyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide (PubChem CID 130449481) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is 2-N-tert-butyl-8-N-[2-(1,3-oxazol-2-yl)propyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide.
| Compound Name | 2-N-tert-butyl-8-N-[2-(1,3-oxazol-2-yl)propyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
|---|---|
| PubChem CID | 130449481 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | 2-N-tert-butyl-8-N-[2-(1,3-oxazol-2-yl)propyl]-5-[3-(trifluoromethyl)phenyl]-3,4,8,8a-tetrahydro-1H-isoquinoline-2,8-dicarboxamide |
| SMILES | CC(CNC(=O)C1C=CC(c2cccc(C(F)(F)F)c2)=C2CCN(C(=O)NC(C)(C)C)CC21)c1ncco1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-17(25-32-11-13-38-25)15-33-24(36)22-9-8-20(18-6-5-7-19(14-18)28(29,30)31)21-10-12-35(16-23(21)22)26(37)34-27(2,3)4/h5-9,11,13-14,17,22-23H,10,12,15-16H2,1-4H3,(H,33,36)(H,34,37) |
| InChIKey | JCUUVQBLVYEEMJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |