C15H29N3 — CID 130449882
(2R)-1-N-ethyl-1-N,2-N-dimethyl-2-N-[(E)-[(Z)-3-methylidenehex-4-en-2-ylidene]amino]butane-1,2-diamine (PubChem CID 130449882) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (2R)-1-N-ethyl-1-N,2-N-dimethyl-2-N-[(E)-[(Z)-3-methylidenehex-4-en-2-ylidene]amino]butane-1,2-diamine.
| Compound Name | (2R)-1-N-ethyl-1-N,2-N-dimethyl-2-N-[(E)-[(Z)-3-methylidenehex-4-en-2-ylidene]amino]butane-1,2-diamine |
|---|---|
| PubChem CID | 130449882 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (2R)-1-N-ethyl-1-N,2-N-dimethyl-2-N-[(E)-[(Z)-3-methylidenehex-4-en-2-ylidene]amino]butane-1,2-diamine |
| SMILES | C=C(/C=C\C)/C(C)=N/N(C)[C@H](CC)CN(C)CC |
| InChI | InChI=1S/C15H29N3/c1-8-11-13(4)14(5)16-18(7)15(9-2)12-17(6)10-3/h8,11,15H,4,9-10,12H2,1-3,5-7H3/b11-8-,16-14+/t15-/m1/s1 |
| InChIKey | FQTPEKIXQMSMLH-BWTGAGFMSA-N |
| XLogP | 3.16 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|