C53H40N2S — CID 130449911
3-[3-amino-5-[3-[10-(3-naphthalen-1-ylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-2-[(Z)-prop-1-enyl]indol-1-yl]benzenethiol (PubChem CID 130449911) has the molecular formula C53H40N2S and a molecular weight of 736.98 g/mol. Its IUPAC name is 3-[3-amino-5-[3-[10-(3-naphthalen-1-ylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-2-[(Z)-prop-1-enyl]indol-1-yl]benzenethiol.
| Compound Name | 3-[3-amino-5-[3-[10-(3-naphthalen-1-ylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-2-[(Z)-prop-1-enyl]indol-1-yl]benzenethiol |
|---|---|
| PubChem CID | 130449911 |
| Molecular Formula | C53H40N2S |
| Molecular Weight | 736.98 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | 3-[3-amino-5-[3-[10-(3-naphthalen-1-ylphenyl)-3,4-dihydroanthracen-9-yl]phenyl]-2-[(Z)-prop-1-enyl]indol-1-yl]benzenethiol |
| SMILES | C/C=C\c1c(N)c2cc(-c3cccc(-c4c5c(c(-c6cccc(-c7cccc8ccccc78)c6)c6ccccc46)CCC=C5)c3)ccc2n1-c1cccc(S)c1 |
| InChI | InChI=1S/C53H40N2S/c1-2-13-50-53(54)48-32-36(28-29-49(48)55(50)40-20-12-21-41(56)33-40)35-16-9-18-38(30-35)51-44-23-5-7-25-46(44)52(47-26-8-6-24-45(47)51)39-19-10-17-37(31-39)43-27-11-15-34-14-3-4-22-42(34)43/h2-7,9-25,27-33,56H,8,26,54H2,1H3/b13-2- |
| InChIKey | MTGFIDBXURMBRI-SILLCRNTSA-N |
| XLogP | 14.47 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.98 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|