C16H30N2 — CID 130449954
N'-[(4E,6Z)-6-propylidenedeca-1,4-dien-5-yl]propane-1,3-diamine (PubChem CID 130449954) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N'-[(4E,6Z)-6-propylidenedeca-1,4-dien-5-yl]propane-1,3-diamine.
| Compound Name | N'-[(4E,6Z)-6-propylidenedeca-1,4-dien-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 130449954 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N'-[(4E,6Z)-6-propylidenedeca-1,4-dien-5-yl]propane-1,3-diamine |
| SMILES | C=CC/C=C(NCCCN)\C(=C/CC)CCCC |
| InChI | InChI=1S/C16H30N2/c1-4-7-11-15(10-6-3)16(12-8-5-2)18-14-9-13-17/h5,10,12,18H,2,4,6-9,11,13-14,17H2,1,3H3/b15-10-,16-12+ |
| InChIKey | YPMIIOYFSHBSPC-RWIOWDNPSA-N |
| XLogP | 3.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|