C14H26N2 — CID 130450116
(2E,4E,6Z)-5-N-butyl-5-N-ethylocta-2,4,6-triene-1,5-diamine (PubChem CID 130450116) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (2E,4E,6Z)-5-N-butyl-5-N-ethylocta-2,4,6-triene-1,5-diamine.
| Compound Name | (2E,4E,6Z)-5-N-butyl-5-N-ethylocta-2,4,6-triene-1,5-diamine |
|---|---|
| PubChem CID | 130450116 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (2E,4E,6Z)-5-N-butyl-5-N-ethylocta-2,4,6-triene-1,5-diamine |
| SMILES | C/C=C\C(=C/C=C/CN)N(CC)CCCC |
| InChI | InChI=1S/C14H26N2/c1-4-7-13-16(6-3)14(10-5-2)11-8-9-12-15/h5,8-11H,4,6-7,12-13,15H2,1-3H3/b9-8+,10-5-,14-11+ |
| InChIKey | VVRLQEIIPRUGFP-SZUJXQEJSA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|