C23H31NO2 — CID 130450362
4-[[4-(4-methoxyphenyl)phenoxy]methyl]-N-propylcyclohexan-1-amine (PubChem CID 130450362) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[[4-(4-methoxyphenyl)phenoxy]methyl]-N-propylcyclohexan-1-amine.
| Compound Name | 4-[[4-(4-methoxyphenyl)phenoxy]methyl]-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 130450362 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-[[4-(4-methoxyphenyl)phenoxy]methyl]-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(COc2ccc(-c3ccc(OC)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H31NO2/c1-3-16-24-21-10-4-18(5-11-21)17-26-23-14-8-20(9-15-23)19-6-12-22(25-2)13-7-19/h6-9,12-15,18,21,24H,3-5,10-11,16-17H2,1-2H3 |
| InChIKey | XEPZLLHEVVFCMC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |