C15H21ClN4OS — CID 130450444
N-[3-chloro-1-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]pyrazol-4-yl]-N-methyl-2-methylsulfanylbutanamide (PubChem CID 130450444) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is N-[3-chloro-1-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]pyrazol-4-yl]-N-methyl-2-methylsulfanylbutanamide.
| Compound Name | N-[3-chloro-1-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]pyrazol-4-yl]-N-methyl-2-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 130450444 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[3-chloro-1-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]pyrazol-4-yl]-N-methyl-2-methylsulfanylbutanamide |
| SMILES | C=N/C=C\C=C(/C)n1cc(N(C)C(=O)C(CC)SC)c(Cl)n1 |
| InChI | InChI=1S/C15H21ClN4OS/c1-6-13(22-5)15(21)19(4)12-10-20(18-14(12)16)11(2)8-7-9-17-3/h7-10,13H,3,6H2,1-2,4-5H3/b9-7-,11-8+ |
| InChIKey | YSRMGIYCDCIFNT-BYSFRFKNSA-N |
| XLogP | 3.72 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|