C24H28N4O2 — CID 130451185
4-[3-(2-benzyl-1,3-dioxolan-2-yl)-1-phenylpropyl]pyridine-2,3,6-triamine (PubChem CID 130451185) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[3-(2-benzyl-1,3-dioxolan-2-yl)-1-phenylpropyl]pyridine-2,3,6-triamine.
| Compound Name | 4-[3-(2-benzyl-1,3-dioxolan-2-yl)-1-phenylpropyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 130451185 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-[3-(2-benzyl-1,3-dioxolan-2-yl)-1-phenylpropyl]pyridine-2,3,6-triamine |
| SMILES | Nc1cc(C(CCC2(Cc3ccccc3)OCCO2)c2ccccc2)c(N)c(N)n1 |
| InChI | InChI=1S/C24H28N4O2/c25-21-15-20(22(26)23(27)28-21)19(18-9-5-2-6-10-18)11-12-24(29-13-14-30-24)16-17-7-3-1-4-8-17/h1-10,15,19H,11-14,16,26H2,(H4,25,27,28) |
| InChIKey | IZTNWGCSCMJFNM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |