C15H23N — CID 130451575
1,2,2,3-tetramethyl-4-(2-methylphenyl)pyrrolidine (PubChem CID 130451575) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-4-(2-methylphenyl)pyrrolidine.
| Compound Name | 1,2,2,3-tetramethyl-4-(2-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 130451575 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1,2,2,3-tetramethyl-4-(2-methylphenyl)pyrrolidine |
| SMILES | Cc1ccccc1C1CN(C)C(C)(C)C1C |
| InChI | InChI=1S/C15H23N/c1-11-8-6-7-9-13(11)14-10-16(5)15(3,4)12(14)2/h6-9,12,14H,10H2,1-5H3 |
| InChIKey | OYRYBGZXRFWNHH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |