C4H9N5 — CID 13045202
3-N-ethyl-1H-1,2,4-triazole-3,5-diamine (PubChem CID 13045202) has the molecular formula C4H9N5 and a molecular weight of 127.15 g/mol. Its IUPAC name is 3-N-ethyl-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-ethyl-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 13045202 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 3-N-ethyl-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C4H9N5/c1-2-6-4-7-3(5)8-9-4/h2H2,1H3,(H4,5,6,7,8,9) |
| InChIKey | INXLBBMSXGKPRE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |