C17H27FN2O — CID 130452177
(1S,2S,4S)-2-fluoro-4-[(Z)-2-[[(1S)-6-methylcyclohex-3-en-1-yl]methylamino]-1-(methylideneamino)ethenyl]cyclohexan-1-ol (PubChem CID 130452177) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is (1S,2S,4S)-2-fluoro-4-[(Z)-2-[[(1S)-6-methylcyclohex-3-en-1-yl]methylamino]-1-(methylideneamino)ethenyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,4S)-2-fluoro-4-[(Z)-2-[[(1S)-6-methylcyclohex-3-en-1-yl]methylamino]-1-(methylideneamino)ethenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 130452177 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (1S,2S,4S)-2-fluoro-4-[(Z)-2-[[(1S)-6-methylcyclohex-3-en-1-yl]methylamino]-1-(methylideneamino)ethenyl]cyclohexan-1-ol |
| SMILES | C=N/C(=C\NC[C@H]1CC=CCC1C)[C@H]1CC[C@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C17H27FN2O/c1-12-5-3-4-6-14(12)10-20-11-16(19-2)13-7-8-17(21)15(18)9-13/h3-4,11-15,17,20-21H,2,5-10H2,1H3/b16-11-/t12?,13-,14+,15-,17-/m0/s1 |
| InChIKey | USJCGIPMGVWNSM-DPRJPOSWSA-N |
| XLogP | 3.22 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|