C28H20N2O2 — CID 130452511
9-(2-nitrocyclohexa-1,5-dien-1-yl)-11-phenylbenzo[a]carbazole (PubChem CID 130452511) has the molecular formula C28H20N2O2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 9-(2-nitrocyclohexa-1,5-dien-1-yl)-11-phenylbenzo[a]carbazole.
| Compound Name | 9-(2-nitrocyclohexa-1,5-dien-1-yl)-11-phenylbenzo[a]carbazole |
|---|---|
| PubChem CID | 130452511 |
| Molecular Formula | C28H20N2O2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 9-(2-nitrocyclohexa-1,5-dien-1-yl)-11-phenylbenzo[a]carbazole |
| SMILES | O=[N+]([O-])C1=C(c2ccc3c4ccc5ccccc5c4n(-c4ccccc4)c3c2)C=CCC1 |
| InChI | InChI=1S/C28H20N2O2/c31-30(32)26-13-7-6-11-22(26)20-15-16-24-25-17-14-19-8-4-5-12-23(19)28(25)29(27(24)18-20)21-9-2-1-3-10-21/h1-6,8-12,14-18H,7,13H2 |
| InChIKey | NJCCJUJNCAVYOB-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|