About (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine
(6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 130453344) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 130453344 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | C[C@H]1C=c2[nH]ccc2=CN1 |
| InChI | InChI=1S/C8H10N2/c1-6-4-8-7(5-10-6)2-3-9-8/h2-6,9-10H,1H3/t6-/m0/s1 |
| InChIKey | POJKHYLUPFRJBC-LURJTMIESA-N |
| XLogP | -0.48 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine (CID 130453344) is (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine is C[C@H]1C=c2[nH]ccc2=CN1.
What is the InChIKey of (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is POJKHYLUPFRJBC-LURJTMIESA-N. The full InChI is InChI=1S/C8H10N2/c1-6-4-8-7(5-10-6)2-3-9-8/h2-6,9-10H,1H3/t6-/m0/s1.
What are the key properties of (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine?
(6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 134.18 g/mol, XLogP of -0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-methyl-5,6-dihydro-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 130453344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).