C21H30FN3O2 — CID 130453454
piperidin-4-yl 4-fluoro-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 130453454) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is piperidin-4-yl 4-fluoro-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | piperidin-4-yl 4-fluoro-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130453454 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | piperidin-4-yl 4-fluoro-4-[[(2-phenylcyclopropyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | O=C(OC1CCNCC1)N1CCC(F)(CNC2CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-21(15-24-19-14-18(19)16-4-2-1-3-5-16)8-12-25(13-9-21)20(26)27-17-6-10-23-11-7-17/h1-5,17-19,23-24H,6-15H2 |
| InChIKey | AODZWOBXFLDGQH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |