About 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one
3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one (PubChem CID 130453696) has the molecular formula C15H12F4N4O2
and a molecular weight of 356.28 g/mol. Its IUPAC name is 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one.
Molecular Properties
| Compound Name | 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one |
| PubChem CID | 130453696 |
| Molecular Formula | C15H12F4N4O2 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one |
| SMILES | CN1COCN(c2ccc(-c3cncc(F)c3)nc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C15H12F4N4O2/c1-22-7-25-8-23(14(22)24)12-3-2-11(21-13(12)15(17,18)19)9-4-10(16)6-20-5-9/h2-6H,7-8H2,1H3 |
| InChIKey | QGKGUERIRDBOMZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one?
The IUPAC name of 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one (CID 130453696) is 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one.
What is the SMILES notation for 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one?
The canonical SMILES for 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one is CN1COCN(c2ccc(-c3cncc(F)c3)nc2C(F)(F)F)C1=O.
What is the InChIKey of 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one?
The InChIKey is QGKGUERIRDBOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F4N4O2/c1-22-7-25-8-23(14(22)24)12-3-2-11(21-13(12)15(17,18)19)9-4-10(16)6-20-5-9/h2-6H,7-8H2,1H3.
What are the key properties of 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one?
3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one has a molecular weight of 356.28 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,3,5-oxadiazinan-4-one is sourced from PubChem (CID 130453696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).