C24H23N5 — CID 130454475
3-[5-(1-benzylpyrrolidin-3-yl)-1H-1,2,4-triazol-3-yl]-5-phenylpyridine (PubChem CID 130454475) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[5-(1-benzylpyrrolidin-3-yl)-1H-1,2,4-triazol-3-yl]-5-phenylpyridine.
| Compound Name | 3-[5-(1-benzylpyrrolidin-3-yl)-1H-1,2,4-triazol-3-yl]-5-phenylpyridine |
|---|---|
| PubChem CID | 130454475 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-[5-(1-benzylpyrrolidin-3-yl)-1H-1,2,4-triazol-3-yl]-5-phenylpyridine |
| SMILES | c1ccc(CN2CCC(c3nc(-c4cncc(-c5ccccc5)c4)n[nH]3)C2)cc1 |
| InChI | InChI=1S/C24H23N5/c1-3-7-18(8-4-1)16-29-12-11-20(17-29)23-26-24(28-27-23)22-13-21(14-25-15-22)19-9-5-2-6-10-19/h1-10,13-15,20H,11-12,16-17H2,(H,26,27,28) |
| InChIKey | PAQZZKZYUVTBIM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |