C8H12N4 — CID 130455126
N,N-bis(prop-2-enyl)-1,2,4-triazol-1-amine (PubChem CID 130455126) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-1,2,4-triazol-1-amine.
| Compound Name | N,N-bis(prop-2-enyl)-1,2,4-triazol-1-amine |
|---|---|
| PubChem CID | 130455126 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | N,N-bis(prop-2-enyl)-1,2,4-triazol-1-amine |
| SMILES | C=CCN(CC=C)n1cncn1 |
| InChI | InChI=1S/C8H12N4/c1-3-5-11(6-4-2)12-8-9-7-10-12/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | ZDKWXCGJPQEYFA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|